CAS 40372-06-3

1-(2-Deoxy-β-D-erythro-pentofuranosyl)-1H-1,2,4-triazole-3-carboxamide

Description:

1-(2-Deoxy-β-D-erythro-pentofuranosyl)-1H-1,2,4-triazole-3-carboxamide, with the CAS number 40372-06-3, is a chemical compound that features a triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound is characterized by its glycosyl moiety, specifically a deoxypentofuranosyl group, indicating that it is a nucleoside analog. The presence of the carboxamide functional group contributes to its potential biological activity, particularly in the context of antiviral or antimicrobial properties. The structural configuration suggests that it may interact with biological macromolecules, such as nucleic acids or proteins, influencing their function. Its solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. This compound is of interest in medicinal chemistry and pharmacology, where it may serve as a lead compound for the development of therapeutic agents. Further studies would be necessary to elucidate its specific biological activities and potential applications in drug development.

Formula: C₈H₁₂N₄O₄

InChI: InChI=1S/C8H12N4O4/c9-7(15)8-10-3-12(11-8)6-1-4(14)5(2-13)16-6/h3-6,13-14H,1-2H2,(H2,9,15)/t4-,5+,6+/m0/s1

InChI key: InChIKey=GODSJHAJEWFDAD-KVQBGUIXSA-N

SMILES: C(N)(=O)C1=NN(C=N1)[C@@H]2O[C@H](CO)[C@@H](O)C2

Synonyms:

• 1-(2-Deoxy-β-D-ribofuranosyl)-1,2,4-triazole-3-carboxamide
• 1-(2-Deoxy-β-D-erythro-pentofuranosyl)-1H-1,2,4-triazole-3-carboxamide
• 2′-Deoxyribavirin
• 1H-1,2,4-Triazole-3-carboxamide, 1-(2-deoxy-β-D-erythro-pentofuranosyl)-

2'-Deoxyribavirin

CAS: 40372-06-3

Intermediate in the synthesis of ribavirin

Formula: C₈H₁₂N₄O₄

Purity: Min. 95%

Molecular weight: 228.21 g/mol

Ref: 3D-ID167157

2'-Deoxyribavirin

Controlled Product

CAS: 40372-06-3

Formula: C₈H₁₂N₄O₄

Color and Shape: Neat

Molecular weight: 228.205

Ref: TR-D249935