CAS 40372-95-0
:2-chloro-N-(2-chloroethyl)-N-(3-iodobenzyl)ethanamine
Description:
2-Chloro-N-(2-chloroethyl)-N-(3-iodobenzyl)ethanamine is a chemical compound characterized by its complex structure, which includes a chloroethyl group and an iodobenzyl moiety. This compound features a primary amine functional group, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of chlorine and iodine atoms in its structure suggests that it may exhibit unique properties, such as increased lipophilicity and potential biological activity. The compound's molecular framework allows for various interactions, making it a candidate for further studies in drug development or as a reagent in chemical reactions. Additionally, the presence of halogens can influence the compound's stability, solubility, and reactivity, which are critical factors in its practical applications. As with many halogenated compounds, safety considerations regarding toxicity and environmental impact should be taken into account when handling or utilizing this substance in research or industrial settings.
Formula:C11H14Cl2IN
InChI:InChI=1/C11H14Cl2IN/c12-4-6-15(7-5-13)9-10-2-1-3-11(14)8-10/h1-3,8H,4-7,9H2
Synonyms:- benzenemethanamine, N,N-bis(2-chloroethyl)-3-iodo-
- 2-Chloro-N-(2-chloroethyl)-N-(3-iodobenzyl)ethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N,N-Bis(2-chloroethyl)-m-iodobenzylamine
CAS:Benzenemethanamine, N,N-bis(2-chloroethyl)-3-iodo- (9CI) is a bioactive chemical.Formula:C11H14Cl2INColor and Shape:SolidMolecular weight:358.05
