CAS 40377-41-1

N-[2-(4-aminophenyl)ethyl]acetamide

Description:

N-[2-(4-aminophenyl)ethyl]acetamide, also known by its CAS number 40377-41-1, is an organic compound characterized by its amide functional group. This substance features a phenyl ring substituted with an amino group, which contributes to its potential biological activity. The presence of the acetamide moiety indicates that it can participate in hydrogen bonding, influencing its solubility and reactivity. Typically, compounds like this may exhibit properties such as moderate polarity, which can affect their interaction with biological systems. The structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both an amine and an acetamide group, which can enhance binding interactions with biological targets. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, N-[2-(4-aminophenyl)ethyl]acetamide is a compound of interest for further research in various chemical and biological contexts.

Formula: C₁₀H₁₄N₂O

InChI: InChI=1/C10H14N2O/c1-8(13)12-7-6-9-2-4-10(11)5-3-9/h2-5H,6-7,11H2,1H3,(H,12,13)

SMILES: CC(=NCCc1ccc(cc1)N)O

N-(4-AMINOPHENETHYL)ACETAMIDE

CAS: 40377-41-1

Formula: C₁₀H₁₄N₂O

Purity: 95.0%

Molecular weight: 178.235

Ref: 10-F535526