CAS 4038-13-5

(2,5-dimethoxyphenyl)(phenyl)methanone

Description:

(2,5-Dimethoxyphenyl)(phenyl)methanone, with the CAS number 4038-13-5, is an organic compound characterized by its structure, which includes a phenyl group and a methanone functional group attached to a dimethoxy-substituted phenyl ring. This compound typically exhibits properties associated with aromatic ketones, such as stability and relatively low reactivity under standard conditions. The presence of methoxy groups enhances its solubility in organic solvents and may influence its electronic properties, potentially making it a candidate for various applications in organic synthesis and medicinal chemistry. The dimethoxy substitution can also affect the compound's reactivity and interaction with biological systems, making it of interest in pharmacological studies. Additionally, due to its aromatic nature, it may exhibit UV-Vis absorbance characteristics, which can be useful in analytical applications. Overall, (2,5-dimethoxyphenyl)(phenyl)methanone is a compound of interest for its structural features and potential applications in various fields of chemistry.

Formula: C₁₅H₁₄O₃

InChI: InChI=1/C15H14O3/c1-17-12-8-9-14(18-2)13(10-12)15(16)11-6-4-3-5-7-11/h3-10H,1-2H3

SMILES: COc1ccc(c(c1)C(=O)c1ccccc1)OC

Synonyms:

• (2,5-Dimethoxy-phenyl)-phenyl-methanone

(2,5-Dimethoxyphenyl)(phenyl)methanone

CAS: 4038-13-5

Versatile small molecule scaffold

Formula: C₁₅H₁₄O₃

Purity: Min. 95%

Molecular weight: 242.27 g/mol

Ref: 3D-EAA03813