CAS 4038-14-6
:3,4-Dimethoxybenzophenone
Description:
3,4-Dimethoxybenzophenone, with the CAS number 4038-14-6, is an organic compound that belongs to the class of benzophenones, which are characterized by their two aromatic rings connected by a carbonyl group. This compound features two methoxy (-OCH₃) groups positioned at the 3 and 4 positions of one of the aromatic rings, contributing to its chemical properties and reactivity. It is typically a white to pale yellow solid with a moderate melting point and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water. 3,4-Dimethoxybenzophenone is primarily used as a UV filter in various applications, including cosmetics and plastics, due to its ability to absorb ultraviolet light and protect materials from photodegradation. Additionally, it may exhibit potential biological activities, making it of interest in pharmaceutical research. As with many organic compounds, handling should be done with care, following appropriate safety guidelines to minimize exposure and environmental impact.
Formula:C15H14O3
InChI:InChI=1/C15H14O3/c1-17-13-9-8-12(10-14(13)18-2)15(16)11-6-4-3-5-7-11/h3-10H,1-2H3
SMILES:COc1ccc(cc1OC)C(=O)c1ccccc1
Synonyms:- (3,4-Dimethoxy-Phenyl)-Phenyl-Methanone
- (3,4-Dimethoxyphenyl)phenyl-methanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methanone, (3,4-dimethoxyphenyl)phenyl-
CAS:Formula:C15H14O3Purity:98%Color and Shape:SolidMolecular weight:242.26993,4-Dimethoxybenzophenone
CAS:3,4-DimethoxybenzophenonePurity:98%Color and Shape:PowderMolecular weight:242.27g/mol3,4-Dimethoxybenzophenone
CAS:The synthesis of 3,4-dimethoxybenzophenone is carried out by the reaction of benzoyl chloride with 2-methoxy-5-methylbenzophenone. The reaction is catalyzed by phosphotungstic acid or zirconium. This method provides a high yield of product and has been used to synthesize 3,4-dimethoxybenzophenone for industrial purposes. The monomers are converted into polymers through acetoxylation and carbonyl group reactions. This process can be carried out in homogeneous solvents at temperatures between 100°C and 200°C.Formula:C15H14O3Purity:Min. 95%Color and Shape:PowderMolecular weight:242.27 g/mol(3,4-Dimethoxyphenyl)(phenyl)methanone
CAS:Formula:C15H14O3Purity:98%Color and Shape:SolidMolecular weight:242.274



