CAS 4038-49-7

2-amino-6-methyl-5-(3-methylbutyl)pyrimidin-4(1H)-one

Description:

2-amino-6-methyl-5-(3-methylbutyl)pyrimidin-4(1H)-one, with the CAS number 4038-49-7, is a pyrimidine derivative characterized by its unique structural features. This compound contains an amino group at the 2-position, a methyl group at the 6-position, and a branched alkyl substituent (3-methylbutyl) at the 5-position of the pyrimidine ring. The presence of the carbonyl group at the 4-position contributes to its reactivity and potential biological activity. Typically, pyrimidine derivatives exhibit a range of pharmacological properties, including antimicrobial and antiviral activities, making them of interest in medicinal chemistry. The molecular structure suggests that it may participate in hydrogen bonding due to the amino and carbonyl functionalities, influencing its solubility and interaction with biological targets. Additionally, the branched alkyl group may enhance lipophilicity, affecting the compound's absorption and distribution in biological systems. Overall, this compound's characteristics position it as a potentially valuable entity for further research in drug development and related fields.

Formula: C₁₀H₁₇N₃O

InChI: InChI=1/C10H17N3O/c1-6(2)4-5-8-7(3)12-10(11)13-9(8)14/h6H,4-5H2,1-3H3,(H3,11,12,13,14)

SMILES: CC(C)CCc1c(C)[nH]c(=N)nc1O

Synonyms:

• 2-Amino-5-Isopentyl-6-Methylpyrimidin-4-Ol

2-Amino-4-hydroxy-6-methyl-5-(3-methylbutyl)pyrimidine

CAS: 4038-49-7

2-Amino-4-hydroxy-6-methyl-5-(3-methylbutyl)pyrimidine

Purity: ≥95%

Molecular weight: 195.26g/mol

Ref: 54-OR5002