CymitQuimica logo

CAS 403848-30-6

:

4H-Thieno[2,3-b]thiopyran-2-sulfonyl chloride, 4-(acetylethylamino)-5,6-dihydro-6-methyl-, 7,7-dioxide, (4S,6S)-

Description:
4H-Thieno[2,3-b]thiopyran-2-sulfonyl chloride, 4-(acetylethylamino)-5,6-dihydro-6-methyl-, 7,7-dioxide, (4S,6S)- is a complex organic compound characterized by its thieno-thiopyran structure, which incorporates a sulfonyl chloride functional group. This compound features a bicyclic system that includes a thiophene ring fused to a pyran, contributing to its unique chemical properties. The presence of the sulfonyl chloride group indicates that it is reactive, particularly towards nucleophiles, making it useful in various synthetic applications. The acetylethylamino substituent adds to its molecular complexity and may influence its biological activity. The stereochemistry, denoted by (4S,6S), suggests specific spatial arrangements of atoms, which can significantly affect the compound's reactivity and interactions with biological targets. Overall, this compound is of interest in medicinal chemistry and may have potential applications in drug development or as a reagent in organic synthesis. Its specific characteristics, including solubility and stability, would depend on the surrounding conditions and the presence of other functional groups.
Formula:C12H16ClNO5S3
InChI:InChI=1S/C12H16ClNO5S3/c1-4-14(8(3)15)10-5-7(2)21(16,17)12-9(10)6-11(20-12)22(13,18)19/h6-7,10H,4-5H2,1-3H3/t7-,10-/m0/s1
InChI key:InChIKey=UQKNTDOUGNFSHG-XVKPBYJWSA-N
SMILES:N(C(C)=O)(CC)[C@@H]1C2=C(SC(S(Cl)(=O)=O)=C2)S(=O)(=O)[C@@H](C)C1
Synonyms:
  • 4H-Thieno[2,3-b]thiopyran-2-sulfonyl chloride, 4-(acetylethylamino)-5,6-dihydro-6-methyl-, 7,7-dioxide, (4S,6S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.