CAS 403860-08-2

Methyl 2-chloro-4H-thieno[3,2-b]pyrrole-5-carboxylate

Description:

Methyl 2-chloro-4H-thieno[3,2-b]pyrrole-5-carboxylate is a heterocyclic compound characterized by its unique thieno-pyrrole structure, which incorporates both sulfur and nitrogen atoms in its ring system. This compound features a methyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of a chlorine atom enhances its electrophilic properties, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Its thieno[3,2-b]pyrrole framework is known for its applications in organic electronics, particularly in the development of organic semiconductors and photovoltaic materials. The compound's structural features may also impart biological activity, making it of interest in medicinal chemistry. Additionally, its synthesis typically involves multi-step organic reactions, which can include cyclization and functional group transformations. Overall, Methyl 2-chloro-4H-thieno[3,2-b]pyrrole-5-carboxylate is a versatile compound with potential applications in both materials science and pharmaceuticals.

Formula: C₈H₆ClNO₂S

InChI: InChI=1S/C8H6ClNO2S/c1-12-8(11)5-2-6-4(10-5)3-7(9)13-6/h2-3,10H,1H3

InChI key: InChIKey=QETCAFYGBABJCO-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=CC2=C(N1)C=C(Cl)S2

Synonyms:

• Methyl 2-chloro-4H-thieno[3,2-b]pyrrole-5-carboxylate
• 4H-Thieno[3,2-b]pyrrole-5-carboxylic acid, 2-chloro-, methyl ester

Methyl 2-chloro-4H-thieno[3,2-b]pyrrole-5-carboxylate

CAS: 403860-08-2

Purity: 97%

Molecular weight: 215.6499939

Ref: 10-F610533

Methyl 2-chloro-4H-thieno[3,2-b]pyrrole-5-carboxylate

CAS: 403860-08-2

Versatile small molecule scaffold

Formula: C₈H₆ClNO₂S

Purity: Min. 95%

Molecular weight: 215.66 g/mol

Ref: 3D-DRA86008