CAS 4039-31-0
:diethyl (2-oxocyclohexyl)propanedioate
Description:
Diethyl (2-oxocyclohexyl)propanedioate, with the CAS number 4039-31-0, is an organic compound characterized by its ester functional groups and a cyclohexyl ring. This compound features a propanedioate backbone, which consists of two ester groups attached to a central propanoic acid moiety. The presence of the 2-oxocyclohexyl substituent introduces a cyclic structure that can influence the compound's reactivity and physical properties. Typically, compounds of this nature exhibit moderate solubility in organic solvents and may have limited solubility in water due to their hydrophobic characteristics. The presence of the ester groups suggests that diethyl (2-oxocyclohexyl)propanedioate may participate in various chemical reactions, such as hydrolysis or transesterification. Additionally, its structure may confer specific biological activities, making it of interest in medicinal chemistry or materials science. Overall, this compound's unique structural features contribute to its potential applications in various chemical processes and industries.
Formula:C13H20O5
InChI:InChI=1/C13H20O5/c1-3-17-12(15)11(13(16)18-4-2)9-7-5-6-8-10(9)14/h9,11H,3-8H2,1-2H3
Synonyms:- propanedioic acid, 2-(2-oxocyclohexyl)-, diethyl ester
- Diethyl (2-oxocyclohexyl)malonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
