CAS 403990-81-8

4-ethyl-5-[(2-methylphenoxy)methyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

4-Ethyl-5-[(2-methylphenoxy)methyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features an ethyl group and a 2-methylphenoxy group, contributing to its unique properties and potential applications. The presence of the thione functional group (–S=) indicates that it may exhibit specific reactivity and biological activity, often associated with compounds that contain sulfur. The compound's molecular structure suggests it may have applications in agricultural chemistry, particularly as a fungicide or herbicide, due to the triazole moiety's known efficacy in inhibiting fungal growth. Additionally, the presence of the phenoxy group may enhance its lipophilicity, potentially influencing its bioavailability and interaction with biological systems. As with many synthetic organic compounds, safety and handling precautions are essential, and its environmental impact should be assessed in any practical applications.

Formula: C₁₂H₁₅N₃OS

InChI: InChI=1/C12H15N3OS/c1-3-15-11(13-14-12(15)17)8-16-10-7-5-4-6-9(10)2/h4-7H,3,8H2,1-2H3,(H,14,17)

SMILES: CCn1c(COc2ccccc2C)nnc1S

4-Ethyl-5-[(2-methylphenoxy)methyl]-4H-1,2,4-triazole-3-thiol

CAS: 403990-81-8

Formula: C₁₂H₁₅N₃OS

Purity: 95.0%

Molecular weight: 249.33

Ref: 10-F039079