CAS 404-52-4

1,3-bis(4-fluorophenyl)thiourea

Description:

1,3-bis(4-fluorophenyl)thiourea, with the CAS number 404-52-4, is an organic compound characterized by its thiourea functional group and two para-fluorophenyl substituents. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of fluorine atoms in the para position of the phenyl rings can enhance the compound's lipophilicity and biological activity. It is generally soluble in organic solvents, which makes it useful in synthetic chemistry. The thiourea moiety contributes to its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions. Additionally, the compound may exhibit interesting biological properties, including antimicrobial or antifungal activities, making it a subject of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper safety measures are taken.

Formula: C₁₃H₁₀F₂N₂S

InChI: InChI=1/C13H10F2N2S/c14-9-1-5-11(6-2-9)16-13(18)17-12-7-3-10(15)4-8-12/h1-8H,(H2,16,17,18)

SMILES: c1cc(ccc1F)NC(=S)Nc1ccc(cc1)F

Synonyms:

• N,N'-di(4-fluorophenyl)thiourea
• thiourea, N,N'-bis(4-fluorophenyl)-

N,N'-Bis(4-fluorophenyl)thiourea

CAS: 404-52-4

Formula: C₁₃H₁₀F₂N₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 264.2937

Ref: IN-DA00JF19

U 19963

CAS: 404-52-4

U 19963

Purity: ≥98%

Molecular weight: 264.29g/mol

Ref: 54-BUP09961

U 19963

CAS: 404-52-4

U 19963, an organic compound, inhibits enzymes/receptors, with anti-inflammatory, anti-tumor, and antibacterial effects.

Formula: C₁₃H₁₀F₂N₂S

Purity: 99.94%

Color and Shape: Solid

Molecular weight: 264.29

Ref: TM-T4177

N,N’-bis(4-fluorophenyl)thiourea

CAS: 404-52-4

Formula: C₁₃H₁₀F₂N₂S

Purity: ≥98%

Molecular weight: 264.29

Ref: 10-F426330