CAS 4040-59-9
:1-(bicyclo[2.2.1]hept-2-yl)methanamine
Description:
1-(Bicyclo[2.2.1]hept-2-yl)methanamine, with the CAS number 4040-59-9, is an organic compound characterized by its bicyclic structure, which consists of a bicyclo[2.2.1]heptane framework attached to a methanamine group. This compound features a nitrogen atom in its amine functional group, contributing to its basicity and potential reactivity in various chemical reactions. The bicyclic structure imparts unique steric and electronic properties, influencing its interactions with other molecules. Typically, compounds like this may exhibit moderate solubility in polar solvents due to the presence of the amine group, while their hydrophobic bicyclic portions can lead to lower solubility in non-polar solvents. Additionally, the compound may participate in hydrogen bonding, affecting its boiling and melting points. Its structural characteristics suggest potential applications in organic synthesis, medicinal chemistry, or as a building block for more complex molecules. However, specific reactivity and stability would depend on the surrounding conditions and the presence of other functional groups.
Formula:C8H15N
InChI:InChI=1/C8H15N/c9-5-8-4-6-1-2-7(8)3-6/h6-8H,1-5,9H2
SMILES:C1CC2CC1CC2CN
Synonyms:- Bicyclo[2.2.1]Heptane-2-Methanamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Bicyclo[2.2.1]heptan-2-ylmethanamine hydrochloride
CAS:Controlled Product<p>Bicyclo[2.2.1]heptan-2-ylmethanamine hydrochloride is a chemical compound that is used to treat inflammatory diseases. It has been shown to be effective in animals with experimental arthritis, and it has been found to suppress the production of nitric oxide, which is involved in inflammation. Bicyclo[2.2.1]heptan-2-ylmethanamine hydrochloride binds to proteins and peptides in the body, forming conjugates that are excreted in urine samples or plasma concentrations. The enantiomers of this drug have different effects on the body, with one being more potent than the other. It has been shown that this drug can inhibit cell dysfunction by modulating cell signaling pathways as well as inhibiting inflammatory responses via interactions with opioid receptors on cells. This drug also inhibits the production of inflammatory cytokines such as IL-6 and TNF-α by binding to their</p>Formula:C20H27NOPurity:Min. 95%Molecular weight:297.4 g/mol
