CAS 404010-32-8

[2-Hydroxy-4-(4-morpholinyl)phenyl](4-methoxyphenyl)methanone

Description:

[2-Hydroxy-4-(4-morpholinyl)phenyl](4-methoxyphenyl)methanone, with the CAS number 404010-32-8, is an organic compound characterized by its complex structure, which includes a phenolic hydroxyl group and a methanone moiety. This compound features a morpholine ring, contributing to its potential biological activity and solubility properties. The presence of both a methoxy group and a hydroxyl group suggests that it may exhibit hydrogen bonding capabilities, influencing its reactivity and interactions with other molecules. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical reactions. Additionally, the compound may possess specific pharmacological properties, making it of interest for further research in drug development. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in practical applications.

Formula: C₁₈H₁₉NO₄

InChI: InChI=1S/C18H19NO4/c1-22-15-5-2-13(3-6-15)18(21)16-7-4-14(12-17(16)20)19-8-10-23-11-9-19/h2-7,12,20H,8-11H2,1H3

InChI key: InChIKey=ZBDQIMDKIHLJFD-UHFFFAOYSA-N

SMILES: OC=1C=C(C=CC1C(=O)C2=CC=C(OC)C=C2)N3CCOCC3

Synonyms:

• [2-Hydroxy-4-(4-morpholinyl)phenyl](4-methoxyphenyl)methanone
• Methanone, [2-hydroxy-4-(4-morpholinyl)phenyl](4-methoxyphenyl)-
• (2-Hydroxy-4-morpholinophenyl)(4-methoxyphenyl)methanone

(2-HYDROXY-4-MORPHOLINOPHENYL)(4-METHOXYPHENYL)METHANONE

CAS: 404010-32-8

Formula: C₁₈H₁₉NO₄

Purity: 95.0%

Molecular weight: 313.353

Ref: 10-F306339