CAS 40421-05-4

5H-Dibenz[b,f]azepine-5-carbonyl bromide

Description:

5H-Dibenz[b,f]azepine-5-carbonyl bromide is a chemical compound characterized by its unique bicyclic structure, which includes a dibenzazepine core. This compound features a carbonyl group (C=O) and a bromine atom, contributing to its reactivity and potential applications in organic synthesis. The presence of the bromine atom makes it a useful intermediate in various chemical reactions, including nucleophilic substitutions. The compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the surrounding environment, such as temperature and solvent polarity. As with many brominated compounds, safety precautions should be taken due to potential toxicity and environmental concerns. Overall, 5H-Dibenz[b,f]azepine-5-carbonyl bromide serves as a valuable building block in the synthesis of more complex organic molecules.

Formula: C₁₅H₁₀BrNO

InChI: InChI=1S/C15H10BrNO/c16-15(18)17-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)17/h1-10H

InChI key: InChIKey=KRUYHEHMJWBQRD-UHFFFAOYSA-N

SMILES: C(Br)(=O)N1C=2C(=CC=CC2)C=CC=3C1=CC=CC3

Synonyms:

• 5H-Dibenz[b,f]azepine-5-carbonyl bromide

Iminostilbene N-Carbonyl Bromide

CAS: 40421-05-4

Formula: C₁₅H₁₀BrNO

Molecular weight: 300.16

Ref: 4Z-I-059003

Iminostilbene N-Carbonyl Bromide

CAS: 40421-05-4

Formula: C₁₅H₁₀BrNO

Molecular weight: 300.15

Ref: ST-EA-CP-I32002