CAS 40427-75-6
:N-octyl B-D-galactopyranoside
Description:
N-octyl β-D-galactopyranoside is a non-ionic surfactant and a glycoside, commonly used in biochemical and biophysical research. It is characterized by its hydrophilic galactopyranoside moiety and a hydrophobic octyl chain, which allows it to effectively solubilize membrane proteins and other hydrophobic compounds in aqueous solutions. This compound is typically a white to off-white solid at room temperature and is soluble in water, making it useful for various applications in cell biology and biochemistry. Its surfactant properties facilitate the formation of micelles, which can encapsulate hydrophobic molecules, enhancing their stability and bioavailability. N-octyl β-D-galactopyranoside is often employed in the purification and stabilization of proteins, particularly in the context of membrane protein studies. Additionally, it is known for its low toxicity and biocompatibility, making it suitable for use in biological systems. Proper handling and storage conditions are essential to maintain its stability and effectiveness in experimental applications.
Formula:C14H28O6
InChI:InChI=1/C14H28O6/c1-2-3-4-5-6-7-8-19-14-13(18)12(17)11(16)10(9-15)20-14/h10-18H,2-9H2,1H3/t10?,11-,12+,13?,14-/m1/s1
Synonyms:- Octyl b-D-Glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Octyl-β-D-galactopyranoside
CAS:Formula:C14H28O6Purity:97%Color and Shape:SolidMolecular weight:292.3685(2R,3R,4S,5R,6R)-2-(Hydroxymethyl)-6-(octyloxy)tetrahydro-2H-pyran-3,4,5-triol
CAS:(2R,3R,4S,5R,6R)-2-(Hydroxymethyl)-6-(octyloxy)tetrahydro-2H-pyran-3,4,5-triolPurity:97%Molecular weight:292.37g/molOctyl β-D-galactopyranoside
CAS:Octyl β-D-galactopyranoside is a chemosensor that has been used to detect the presence of aldehydes. The transfer mechanism of octyl β-D-galactopyranoside involves micelles, which are aggregates of amphiphilic molecules that form spherical structures in water. Octyl β-D-galactopyranoside has been shown to have antibacterial activity against gram-positive bacteria and leishmania parasites. This compound is also used as a glycosidase inhibitor, which prevents the breakdown of carbohydrates by enzymes called glycosidases. It is believed that this inhibition occurs because octyl β-D-galactopyranoside binds to the active site of the enzyme, thereby preventing access by the substrate. The optimum temperature for octyl β-D-galactopyranoside's activity is between 20 and 25 degrees Celsius. Octyl β-D-galactopyranosideFormula:C14H28O6Purity:Min. 95%Color and Shape:PowderMolecular weight:292.37 g/molOctyl ß-D-Galactopyranoside extrapure, 98%
CAS:Formula:C14H28O6Purity:min. 98%Color and Shape:White, Crystalline powderMolecular weight:292.37Octyl beta-D-galactopyranoside
CAS:Applications Octyl beta-D-galactopyranoside is a detergent for integral membrane protein solubilization.
Formula:C14H28O6Color and Shape:NeatMolecular weight:292.37





