CAS 40431-45-6

2-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-8-carboxylic acid hydrochloride (1:1)

Description:

2-Methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-8-carboxylic acid hydrochloride is a chemical compound characterized by its complex bicyclic structure, which incorporates both pyridine and indole moieties. This substance typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, reflecting its polar functional groups. The presence of a carboxylic acid group contributes to its acidic properties, while the hydrochloride form indicates that it is a salt, enhancing its solubility and stability in aqueous solutions. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of potential therapeutic agents. Its molecular structure suggests potential interactions with biological targets, which could be explored in medicinal chemistry. As with many chemical substances, safety data should be consulted to understand its handling, toxicity, and environmental impact.

Formula: C₁₃H₁₅ClN₂O₂

InChI: InChI=1/C13H14N2O2.ClH/c1-15-5-4-12-10(7-15)9-6-8(13(16)17)2-3-11(9)14-12;/h2-3,6,14H,4-5,7H2,1H3,(H,16,17);1H

SMILES: CN1CCc2c(C1)c1cc(ccc1[nH]2)C(=O)O.Cl

2-Methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]-indole-8-carboxylic acid hydrochloride

CAS: 40431-45-6

Formula: C₁₃H₁₅ClN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 266.7234

Ref: IN-DA00CK1O

2-Methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-8-carboxylic acid hydrochloride

CAS: 40431-45-6

2-Methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-8-carboxylic acid hydrochloride

Purity: 97%

Molecular weight: 266.73g/mol

Ref: 54-OR1057009

2-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-8-carboxylic acid hydrochloride

CAS: 40431-45-6

Formula: C₁₃H₁₅ClN₂O₂

Molecular weight: 266.73

Ref: 10-F366730