CymitQuimica logo

CAS 404337-71-9

:

1-[(2R)-3,4-dihydro-2H-chromen-2-yl]methanamine

Description:
1-[(2R)-3,4-dihydro-2H-chromen-2-yl]methanamine is an organic compound characterized by its chromene structure, which features a fused benzene and pyran ring. The presence of the amine group (-NH2) indicates that it can participate in hydrogen bonding, influencing its solubility and reactivity. The specific stereochemistry denoted by (2R) suggests that the compound has a chiral center, which may affect its biological activity and interactions with other molecules. This compound is likely to exhibit moderate polarity due to the combination of the hydrophobic chromene moiety and the hydrophilic amine group. Its potential applications may include roles in medicinal chemistry, particularly in the development of pharmaceuticals, given the structural motifs often associated with bioactive compounds. Additionally, the compound's stability, reactivity, and interactions with biological systems would depend on various factors such as pH, temperature, and the presence of other chemical species. Overall, this compound represents a unique structure with potential implications in various chemical and biological contexts.
Formula:C10H13NO
InChI:InChI=1/C10H13NO/c11-7-9-6-5-8-3-1-2-4-10(8)12-9/h1-4,9H,5-7,11H2/t9-/m1/s1
SMILES:c1ccc2c(c1)CC[C@H](CN)O2
Synonyms:
  • (R)-Chroman-2-ylmethanaine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.