CymitQuimica logo

CAS 40439-76-7

:

2-Pyrimidinamine,5-chloro-4-methyl-

Description:
2-Pyrimidinamine, 5-chloro-4-methyl- is an organic compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chlorine atom at the 5-position and a methyl group at the 4-position of the pyrimidine ring contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. It is often used in pharmaceutical research and development, particularly in the synthesis of biologically active compounds. The compound's reactivity can be influenced by the electron-withdrawing nature of the chlorine atom and the electron-donating properties of the amino group, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C5H6ClN3
InChI:InChI=1S/C5H6ClN3/c1-3-4(6)2-8-5(7)9-3/h2H,1H3,(H2,7,8,9)
InChI key:LCQUAQMCNBQPIE-UHFFFAOYSA-N
SMILES:CC1=NC(=NC=C1Cl)N
Synonyms:
  • 2-Amino-4-methyl-5-chloropyrimidine
Found 4 products.