CAS 4044-00-2

5,7-Dihydroxyisoflavone

Description:

5,7-Dihydroxyisoflavone, with the CAS number 4044-00-2, is a naturally occurring isoflavonoid compound primarily found in various plants, particularly in legumes. This compound features a flavonoid structure characterized by two hydroxyl groups located at the 5 and 7 positions of the isoflavone backbone, which contributes to its biological activity. It is known for its potential antioxidant properties, which may help in neutralizing free radicals and reducing oxidative stress. Additionally, 5,7-Dihydroxyisoflavone has been studied for its potential health benefits, including anti-inflammatory effects and possible roles in hormone regulation due to its phytoestrogenic activity. The compound is typically soluble in organic solvents and exhibits moderate solubility in water. Its stability can be influenced by environmental factors such as light and pH. Overall, 5,7-Dihydroxyisoflavone is of interest in both nutritional and pharmaceutical research due to its diverse biological activities and potential therapeutic applications.

Formula: C₁₅H₁₀O₄

InChI: InChI=1S/C15H10O4/c16-10-6-12(17)14-13(7-10)19-8-11(15(14)18)9-4-2-1-3-5-9/h1-8,16-17H

InChI key: InChIKey=PJJGZPJJTHBVMX-UHFFFAOYSA-N

SMILES: O=C1C=2C(OC=C1C3=CC=CC=C3)=CC(O)=CC2O

Synonyms:

• 4H-1-Benzopyran-4-one, 5,7-dihydroxy-3-phenyl-
• 5,7-Dihydroxy-3-phenyl-4H-1-benzopyran-4-one
• 5,7-Dihydroxyisoflavone
• Isoflavone, 5,7-dihydroxy-

5,7-Dihydroxyisoflavone

CAS: 4044-00-2

5,7-Dihydroxyisoflavone is a naturally occurring isoflavone, which is a type of flavonoid compound commonly found in various plants. It is primarily derived from sources such as soybeans and other legumes, which are known to contain a wide array of phytonutrients. The mode of action of 5,7-Dihydroxyisoflavone involves its ability to act as an antioxidant, scavenging free radicals and thereby reducing oxidative stress within biological systems. This function is crucial in preserving cellular health and preventing damage that can lead to chronic diseases.

Formula: C₁₅H₁₀O₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 254.24 g/mol

Ref: 3D-FD66334