CAS 4044-95-5

3-bromo-2-phenylimidazo[1,2-a]pyridine

Description:

3-Bromo-2-phenylimidazo[1,2-a]pyridine is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, along with a phenyl group and a bromine substituent. This compound typically exhibits a pale yellow to brown solid appearance and is known for its potential biological activity, particularly in medicinal chemistry. The presence of the bromine atom can influence its reactivity and solubility, making it a subject of interest in various chemical reactions and applications. Its structure allows for potential interactions with biological targets, which may lead to pharmacological effects. Additionally, the compound may exhibit fluorescence properties, making it useful in certain analytical applications. As with many heterocycles, it may participate in electrophilic and nucleophilic reactions, depending on the conditions. Safety data should be consulted, as halogenated compounds can pose health risks, and proper handling and disposal procedures are essential in laboratory settings. Overall, 3-bromo-2-phenylimidazo[1,2-a]pyridine represents a versatile compound in organic synthesis and medicinal research.

Formula: C₁₃H₉BrN₂

InChI: InChI=1/C13H9BrN2/c14-13-12(10-6-2-1-3-7-10)15-11-8-4-5-9-16(11)13/h1-9H

SMILES: c1ccc(cc1)c1c(Br)n2ccccc2n1

Synonyms:

• 3-Brom-2-phenylimidazo[1,2-a]pyridin
• Imidazo[1,2-A]Pyridine, 3-Bromo-2-Phenyl-
• 3-Bromo-2-phenylimidazo[1,2-a]pyridine

3-Bromo-2-phenylimidazo[1,2-a]pyridine

CAS: 4044-95-5

3-Bromo-2-phenylimidazo[1,2-a]pyridine

Purity: ≥95%

Molecular weight: 273.13g/mol

Ref: 54-OR24761

3-bromo-2-phenylimidazo[1,2-a]pyridine

CAS: 4044-95-5

Purity: 95.0%

Molecular weight: 273.13299560546875

Ref: 10-F526284