CymitQuimica logo

CAS 4044-98-8

:

6-Bromo-2-phenylimidazo[1,2-a]pyridine

Description:
6-Bromo-2-phenylimidazo[1,2-a]pyridine is a heterocyclic organic compound characterized by its imidazo[1,2-a]pyridine core, which features a fused ring system containing nitrogen atoms. The presence of a bromine atom at the 6-position and a phenyl group at the 2-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents. It is of interest in medicinal chemistry due to its potential biological activities, including antimicrobial and anticancer properties. The structure allows for various chemical modifications, making it a versatile scaffold in drug design. Additionally, its reactivity can be influenced by the bromine substituent, which can participate in nucleophilic substitution reactions. Safety data indicates that, like many brominated compounds, it should be handled with care due to potential toxicity. Overall, 6-Bromo-2-phenylimidazo[1,2-a]pyridine serves as a valuable compound in research and development within the fields of organic and medicinal chemistry.
Formula:C13H9BrN2
InChI:InChI=1/C13H9BrN2/c14-11-6-7-13-15-12(9-16(13)8-11)10-4-2-1-3-5-10/h1-9H
InChI key:JECUQJPFGTUNCJ-UHFFFAOYSA-N
SMILES:c1ccc(cc1)c1cn2cc(ccc2n1)Br
Synonyms:
  • Imidazo[1,2-a]pyridine, 6-bromo-2-phenyl-
Found 4 products.