
CAS 40447-04-9
:N-(3-Chloro-2-methylphenyl)benzamide
Description:
N-(3-Chloro-2-methylphenyl)benzamide, with the CAS number 40447-04-9, is an organic compound characterized by its amide functional group and aromatic structure. This compound features a benzamide core, where a benzene ring is attached to a carbonyl group (C=O) linked to a nitrogen atom (N). The presence of a 3-chloro-2-methylphenyl substituent indicates that a chlorine atom and a methyl group are positioned on the aromatic ring, influencing its chemical properties and reactivity. Typically, compounds of this nature exhibit moderate to high lipophilicity due to their aromatic character, which can affect their solubility in organic solvents. Additionally, the chlorine substituent can enhance the compound's biological activity and stability. N-(3-Chloro-2-methylphenyl)benzamide may be of interest in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. As with many organic compounds, safety data sheets should be consulted for handling and toxicity information.
Formula:C14H12ClNO
InChI:InChI=1S/C14H12ClNO/c1-10-12(15)8-5-9-13(10)16-14(17)11-6-3-2-4-7-11/h2-9H,1H3,(H,16,17)
InChI key:InChIKey=YYBZYCYXYZUIHL-UHFFFAOYSA-N
SMILES:N(C(=O)C1=CC=CC=C1)C2=C(C)C(Cl)=CC=C2
Synonyms:- N-(3-Chloro-2-methylphenyl)benzamide
- NSC 164393
- N-(3-Chloro-o-tolyl)benzamide
- Benzamide, N-(3-chloro-2-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.