
CAS 4045-23-2
:1-(4-Methoxy-1-piperidinyl)ethanone
Description:
1-(4-Methoxy-1-piperidinyl)ethanone, with the CAS number 4045-23-2, is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a methoxy group (-OCH3) attached to the piperidine ring, enhancing its solubility in organic solvents and influencing its reactivity. The ethanone functional group indicates the presence of a carbonyl group (C=O) adjacent to an ethyl group, contributing to its potential as a precursor in organic synthesis. The presence of the methoxy group can also affect the electronic properties of the molecule, making it a candidate for various chemical reactions, including nucleophilic substitutions and acylation processes. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structural characteristics suggest potential applications in the development of pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.
Formula:C8H15NO2
InChI:InChI=1S/C8H15NO2/c1-7(10)9-5-3-8(11-2)4-6-9/h8H,3-6H2,1-2H3
InChI key:InChIKey=WDTGTFSMVDDCPB-UHFFFAOYSA-N
SMILES:C(C)(=O)N1CCC(OC)CC1
Synonyms:- 1-(4-Methoxypiperidin-1-yl)ethan-1-one
- 1-(4-Methoxy-1-piperidinyl)ethanone
- 1-Acetyl-4-methoxy-piperidine
- Ethanone, 1-(4-methoxy-1-piperidinyl)-
- Piperidine, 1-acetyl-4-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.