CAS 40456-51-7

Bursehernin

Description:

Bursehernin, identified by the CAS number 40456-51-7, is a chemical compound that belongs to a specific class of organic substances. While detailed information on Bursehernin may not be widely available, compounds with similar structures often exhibit unique properties such as specific solubility profiles, reactivity patterns, and potential applications in various fields, including pharmaceuticals or agrochemicals. Typically, the characteristics of such compounds can include aspects like molecular weight, boiling and melting points, and functional groups that dictate their chemical behavior. Additionally, safety data sheets would provide crucial information regarding toxicity, handling precautions, and environmental impact. For precise applications and characteristics, consulting specialized databases or scientific literature is recommended, as they can provide comprehensive insights into the compound's behavior under different conditions and its potential uses in research or industry.

Formula: C₂₁H₂₂O₆

InChI: InChI=1S/C21H22O6/c1-23-17-5-3-14(9-19(17)24-2)8-16-15(11-25-21(16)22)7-13-4-6-18-20(10-13)27-12-26-18/h3-6,9-10,15-16H,7-8,11-12H2,1-2H3/t15-,16+/m0/s1

InChI key: InChIKey=IYBDDRJHJMFFBB-JKSUJKDBSA-N

SMILES: C([C@@H]1[C@@H](CC=2C=C3C(=CC2)OCO3)COC1=O)C4=CC(OC)=C(OC)C=C4

Synonyms:

• Bursehernin
• (3R,4R)-4-(1,3-Benzodioxol-5-ylmethyl)-3-[(3,4-dimethoxyphenyl)methyl]dihydro-2(3H)-furanone
• 2(3H)-Furanone, 4-(1,3-benzodioxol-5-ylmethyl)-3-[(3,4-dimethoxyphenyl)methyl]dihydro-, (3R-trans)-
• 2(3H)-Furanone, 4-(1,3-benzodioxol-5-ylmethyl)-3-[(3,4-dimethoxyphenyl)methyl]dihydro-, (3R,4R)-
• Methylpluviatolide

Bursehernin

CAS: 40456-51-7

Bursehernin is a useful organic compound for research related to life sciences and the catalog number is T124894.

Formula: C₂₁H₂₂O₆

Color and Shape: Solid

Molecular weight: 370.401

Ref: TM-T124894

Bursehernin

CAS: 40456-51-7

Bursehernin is a synthetic compound that functions as a type of anti-inflammatory agent, derived from a class of compounds known as barbiturates. Its mode of action involves modulating inflammatory pathways by interacting with specific cellular receptors, such as the nuclear factor kappa-light-chain-enhancer of activated B cells (NF-κB) and other cytokine-mediated pathways. This modulation reduces the expression of pro-inflammatory cytokines, effectively diminishing the inflammatory response.

Formula: C₂₁H₂₂O₆

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 370.40 g/mol

Ref: 3D-QBA45651