CAS 404576-50-7

Isoquinoline, 6-butyl-1,2,3,4-tetrahydro-, hydrochloride (1:1)

Description:

Isoquinoline, 6-butyl-1,2,3,4-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its isoquinoline structure, which is a bicyclic compound containing a fused benzene and pyridine ring. The "6-butyl" designation indicates the presence of a butyl group at the 6-position of the isoquinoline ring, contributing to its hydrophobic properties. As a tetrahydro derivative, it features a saturated ring system, which enhances its stability and solubility in various solvents. The hydrochloride form signifies that the compound is a salt formed with hydrochloric acid, which typically improves its solubility in water and may influence its pharmacological properties. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific applications and effects would depend on further research into its interactions and mechanisms of action. Overall, the characteristics of this compound suggest potential utility in various chemical and pharmaceutical contexts.

Formula: C₁₃H₁₉N·ClH

InChI: InChI=1S/C13H19N.ClH/c1-2-3-4-11-5-6-13-10-14-8-7-12(13)9-11;/h5-6,9,14H,2-4,7-8,10H2,1H3;1H

InChI key: InChIKey=HUMOAYMAUBYGMX-UHFFFAOYSA-N

SMILES: C(CCC)C=1C=C2C(=CC1)CNCC2.Cl

Synonyms:

• Isoquinoline, 6-butyl-1,2,3,4-tetrahydro-, hydrochloride
• Isoquinoline, 6-butyl-1,2,3,4-tetrahydro-, hydrochloride (1:1)

6-Butyl-1,2,3,4-tetrahydroisoquinoline hydrochloride

CAS: 404576-50-7

Versatile small molecule scaffold

Formula: C₁₃H₂₀ClN

Purity: Min. 95%

Molecular weight: 225.76 g/mol

Ref: 3D-ERA57650