CAS 40462-12-2

(2Z)-2-benzylidene-1,3-dioxo-2,3-dihydro-1H-indene-5-carboxylic acid

Description:

(2Z)-2-benzylidene-1,3-dioxo-2,3-dihydro-1H-indene-5-carboxylic acid, with CAS number 40462-12-2, is an organic compound characterized by its complex structure that includes a benzylidene group and a dioxo moiety. This compound features a fused indene ring system, which contributes to its aromatic properties and potential reactivity. The presence of carboxylic acid functionality indicates that it can participate in acid-base reactions and may exhibit solubility in polar solvents. The dioxo groups suggest that it may have strong electron-withdrawing characteristics, influencing its reactivity and stability. Additionally, the stereochemistry indicated by the "(2Z)" designation suggests a specific geometric configuration around the double bond, which can affect the compound's physical properties and biological activity. Overall, this compound may be of interest in various fields, including organic synthesis and medicinal chemistry, due to its unique structural features and potential applications.

Formula: C₁₇H₁₀O₄

InChI: InChI=1/C17H10O4/c18-15-12-7-6-11(17(20)21)9-13(12)16(19)14(15)8-10-4-2-1-3-5-10/h1-9H,(H,20,21)/b14-8-

SMILES: c1ccc(cc1)/C=C\1/C(=O)c2ccc(cc2C1=O)C(=O)O

(2Z)-2-benzylidene-1,3-dioxoindane-5-carboxylic acid

CAS: 40462-12-2

Purity: 95.0%

Molecular weight: 278.26300048828125

Ref: 10-F315214