CAS 40477-45-0
:3,4-Dibromo-2,5-dichlorothiophene
Description:
3,4-Dibromo-2,5-dichlorothiophene is a heterocyclic organic compound characterized by its thiophene ring, which is a five-membered aromatic ring containing sulfur. This compound features two bromine atoms and two chlorine atoms substituted at specific positions on the thiophene ring, contributing to its unique chemical properties. The presence of halogens typically enhances the compound's reactivity, making it useful in various chemical syntheses and applications, including as an intermediate in the production of agrochemicals and pharmaceuticals. The molecular structure of 3,4-Dibromo-2,5-dichlorothiophene also influences its physical properties, such as solubility and melting point, which are important for its handling and application in industrial processes. Additionally, the compound's electronic properties may be affected by the halogen substitutions, potentially impacting its behavior in electronic materials or as a dye. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.
Formula:C4Br2Cl2S
InChI:InChI=1/C4Br2Cl2S/c5-1-2(6)4(8)9-3(1)7
SMILES:c1(c(c(Cl)sc1Cl)Br)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3,4-Dibromo-2,5-dichlorothiophene
CAS:Formula:C4Br2Cl2SColor and Shape:SolidMolecular weight:310.8218
