![[(1S,2S)-2-aminocyclopentyl]methanol](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F407148-1s-2s-2-aminocyclopentyl-methanol.webp&w=3840&q=75)
CAS 40482-12-0
:[(1S,2S)-2-aminocyclopentyl]methanol
Description:
[(1S,2S)-2-aminocyclopentyl]methanol is an organic compound characterized by its cyclopentane ring structure, which features an amino group and a hydroxymethyl group. The compound has a chiral center, indicated by the (1S,2S) configuration, which contributes to its stereochemistry and potential biological activity. It is a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the amino group suggests that it may participate in hydrogen bonding, influencing its solubility in polar solvents such as water. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural similarity to various biologically active molecules. Its CAS number, 40482-12-0, allows for easy identification in chemical databases. Overall, [(1S,2S)-2-aminocyclopentyl]methanol is of interest for its potential applications in drug design and synthesis, as well as its unique structural features that may confer specific biological properties.
Formula:C6H13NO
InChI:InChI=1/C6H13NO/c7-6-3-1-2-5(6)4-8/h5-6,8H,1-4,7H2/t5-,6+/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
