CAS 404827-77-6
:6-bromo-1H-indazol-3-amine
Description:
6-Bromo-1H-indazol-3-amine is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a bromine atom at the 6-position and an amino group at the 3-position contributes to its unique reactivity and potential biological activity. This compound is often studied in medicinal chemistry for its potential as a pharmaceutical agent, particularly in the context of targeting specific biological pathways. Its molecular structure allows for various interactions with biological macromolecules, making it a candidate for further research in drug development. Additionally, 6-bromo-1H-indazol-3-amine may exhibit properties such as solubility in organic solvents, which can vary based on the specific conditions and the presence of other functional groups. As with many compounds in this class, safety and handling precautions are essential due to the potential for toxicity and environmental impact. Overall, this compound represents a significant interest in the fields of organic chemistry and pharmacology.
Formula:C7H6BrN3
InChI:InChI=1/C7H6BrN3/c8-4-1-2-5-6(3-4)10-11-7(5)9/h1-3H,(H3,9,10,11)
SMILES:c1cc2c(cc1Br)[nH][nH]c2=N
Synonyms:- 1H-Indazol-3-amine, 6-bromo-
- 6-Bromo-1H-Indazol-3-Ylamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Amino-6-bromo-1H-indazole, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C7H6BrN3Purity:97%Color and Shape:White to pale yellow, PowderMolecular weight:212.056-bromo-1H-indazol-3-amine
CAS:Formula:C7H6BrN3Purity:97%Color and Shape:SolidMolecular weight:212.04663-Amino-6-bromo-1H-indazole
CAS:3-Amino-6-bromo-1H-indazoleFormula:C7H6BrN3Purity:95%Color and Shape: solidMolecular weight:212.05g/mol6-Bromo-1H-indazol-3-amine
CAS:Formula:C7H6BrN3Purity:97%Color and Shape:SolidMolecular weight:212.056-Bromo-1H-indazol-3-yl-amine
CAS:6-Bromo-1H-indazol-3-yl-amine is an indazole derivative that has shown anti-cancer effects in vitro and in vivo. 6-Bromo-1H-indazol-3-yl-amine inhibits the proliferation of cancer cells, which may be due to its inhibition of cell cycle progression at the G2/M phase. It also inhibits the growth of tumor cells by inducing apoptosis. The drug's mechanism of action is not yet fully understood, but it has been shown to inhibit the activity of axitinib, a tyrosine kinase inhibitor. This drug has also shown anti-proliferative activities with acid catalysts and supramolecular systems. In addition, 6-bromo 1H indazol 3 yl amine contains functional groups such as nitro and pyrrole groups.Formula:C7H6BrN3Purity:Min. 95%Molecular weight:212.05 g/mol




