CAS 404827-78-7

4-fluoro-1H-indazol-3-amine

Description:

4-Fluoro-1H-indazol-3-amine is a chemical compound characterized by its indazole core, which is a bicyclic structure consisting of a five-membered ring fused to a six-membered ring. The presence of a fluorine atom at the 4-position and an amino group at the 3-position contributes to its unique reactivity and potential biological activity. This compound is often studied in medicinal chemistry for its potential applications in drug development, particularly in the context of targeting specific biological pathways. It may exhibit properties such as being a potential inhibitor or modulator of certain enzymes or receptors. The molecular structure influences its solubility, stability, and interaction with biological systems. Additionally, 4-fluoro-1H-indazol-3-amine may be synthesized through various organic reactions, and its purity and identity can be confirmed using techniques such as NMR spectroscopy and mass spectrometry. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.

Formula: C₇H₆FN₃

InChI: InChI=1/C7H6FN3/c8-4-2-1-3-5-6(4)7(9)11-10-5/h1-3H,(H3,9,10,11)

SMILES: c1cc(c2c(c1)[nH][nH]c2=N)F

Synonyms:

• 1H-indazol-3-amine, 4-fluoro-
• 1H-Indazol-3-amine,4-fluoro-(9CI)

1H-Indazol-3-amine,4-fluoro-(9CI)

CAS: 404827-78-7

Formula: C₇H₆FN₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 151.1410

Ref: IN-DA00C8F3

3-Amino-4-fluoro-1H-indazole

CAS: 404827-78-7

3-Amino-4-fluoro-1H-indazole

Purity: 96%

Color and Shape: Yellow Solid

Molecular weight: 151.14g/mol

Ref: 54-PC200069

4-Fluoro-1H-indazol-3-amine

CAS: 404827-78-7

Formula: C₇H₆FN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 151.144

Ref: 10-F061502