CAS 40484-36-4

6-(chloromethyl)phenanthridine

Description:

6-(Chloromethyl)phenanthridine is an organic compound characterized by its phenanthridine backbone, which is a polycyclic aromatic structure. The presence of a chloromethyl group at the 6-position introduces both reactivity and potential for further chemical modifications. This compound typically exhibits properties associated with aromatic compounds, such as stability and a tendency to participate in electrophilic substitution reactions. It is likely to be a solid at room temperature, with solubility in organic solvents due to its hydrophobic nature. The chloromethyl group can serve as a functional handle for various synthetic applications, including the formation of carbon-carbon bonds or the introduction of other functional groups. Additionally, compounds like 6-(chloromethyl)phenanthridine may exhibit biological activity, making them of interest in medicinal chemistry and drug development. Safety data should be consulted, as chlorinated compounds can pose health risks, including toxicity and environmental concerns. Overall, 6-(chloromethyl)phenanthridine is a versatile compound with potential applications in organic synthesis and pharmaceuticals.

Formula: C₁₄H₁₀ClN

InChI: InChI=1/C14H10ClN/c15-9-14-12-7-2-1-5-10(12)11-6-3-4-8-13(11)16-14/h1-8H,9H2

SMILES: c1ccc2c(c1)c1ccccc1nc2CCl

6-(Chloromethyl)phenanthridine

CAS: 40484-36-4

Formula: C₁₄H₁₀ClN

Purity: 97%

Color and Shape: Solid

Molecular weight: 227.6889

Ref: IN-DA00CRA2

6-(Chloromethyl)phenanthridine

CAS: 40484-36-4

6-(Chloromethyl)phenanthridine

Purity: 97%

Molecular weight: 227.69g/mol

Ref: 54-OR1056862

6-(Chloromethyl)phenanthridine

CAS: 40484-36-4

6-(Chloromethyl)phenanthridine is a fatty acid that has been shown to have anti-inflammatory effects. It has also been shown to be effective in the treatment of humans and animals with musculoskeletal disorders. 6-(Chloromethyl)phenanthridine is soluble in deionized water and hydroxide solution, but insoluble in ethanol and acetone. This compound can be used as an ingredient in detergent compositions for use on clothes. It can also be used as a microcapsule coating material or as an acid catalyst in the production of soybean extract.

Formula: C₁₄H₁₀ClN

Purity: Min. 95%

Molecular weight: 227.69 g/mol

Ref: 3D-QBA48436