CAS 4049-34-7: β-D-Ribopyranose, 1,2,3,4-tetraacetate
Description:β-D-Ribopyranose, 1,2,3,4-tetraacetate is a derivative of ribose, a pentose sugar that plays a crucial role in biological systems, particularly in the structure of RNA. This compound features a pyranose ring structure, which is a six-membered ring containing five carbon atoms and one oxygen atom. The "tetraacetate" designation indicates that all four hydroxyl groups of ribose have been acetylated, resulting in the formation of acetate esters. This modification enhances the lipophilicity of the molecule, potentially affecting its solubility and reactivity. The compound is typically used in biochemical research and synthesis, particularly in studies involving nucleic acids and carbohydrate chemistry. Its CAS number, 4049-34-7, uniquely identifies this specific chemical substance in chemical databases. As with many acetylated sugars, β-D-Ribopyranose, 1,2,3,4-tetraacetate may exhibit altered biological activity compared to its parent compound, making it a valuable tool for exploring the functions and interactions of ribose in various biochemical contexts.
Formula:C13H18O9
InChI:InChI=1S/C13H18O9/c1-6(14)19-10-5-18-13(22-9(4)17)12(21-8(3)16)11(10)20-7(2)15/h10-13H,5H2,1-4H3/t10-,11-,12-,13+/m1/s1
InChI key:InChIKey=MJOQJPYNENPSSS-LPWJVIDDSA-N
SMILES:O=C(OC1OCC(OC(=O)C)C(OC(=O)C)C1OC(=O)C)C
- Synonyms:
- β-D-Ribopyranose, tetraacetate
- Ribopyranose, tetraacetate, β-D-
- Tetra-O-acetyl-β-D-ribopyranose
- Ribopyranose, tetraacetate
- β-D-Ribopyranose, 1,2,3,4-tetraacetate
Tetra-O-acetyl-β-D-ribopyranose
Ref: 3B-R0065
| 1g | 58.00 € |
β-D-RIBOPYRANOSE 1,2,3,4-TETRAACETATE
Ref: IN-DA003BP0
| 1g | 153.00 € |
Ref: 54-OR1023770
| 100mg | 32.00 € | ||
| 250mg | 45.00 € |
(2S,3R,4R,5R)-Tetrahydro-2H-pyran-2,3,4,5-tetrayl tetraacetate
Ref: 10-F241602
| 1g | To inquire |
1,2,3,4-Tetra-O-acetyl-β-D-ribopyranose
Ref: 3D-MT11561
| 5g | 349.00 € | ||
| 10g | 460.00 € | ||
| 25g | 872.00 € | ||
| 50g | 1,370.00 € | ||
| 100g | 2,002.00 € |
