CAS 40492-52-2

2,3-dihydrobenzofuran-5-ol

Description:

2,3-Dihydrobenzofuran-5-ol is an organic compound characterized by its bicyclic structure, which consists of a benzofuran ring system with a hydroxyl group (-OH) at the 5-position. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents and exhibits moderate polarity due to the presence of the hydroxyl group. The compound is of interest in various fields, including medicinal chemistry and organic synthesis, due to its potential biological activities and applications as an intermediate in the synthesis of more complex molecules. Its reactivity is influenced by the hydroxyl group, which can participate in hydrogen bonding and affect the compound's overall stability and interactions with other substances. Additionally, 2,3-dihydrobenzofuran-5-ol may undergo various chemical transformations, such as oxidation or substitution reactions, making it a versatile building block in organic synthesis. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₈H₈O₂

InChI: InChI=1/C8H8O2/c9-7-1-2-8-6(5-7)3-4-10-8/h1-2,5,9H,3-4H2

SMILES: c1cc2c(CCO2)cc1O

Synonyms:

• 2,3-Dihydro-1-benzofuran-5-ol
• 5-Benzofuranol, 2,3-Dihydro-
• 2,3-Dihydro-Benzofuran-5-Ol

2,3-Dihydro-benzofuran-5-ol

CAS: 40492-52-2

Formula: C₈H₈O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 136.1479

Ref: IN-DA00BY4D

2,3-Dihydro-5-hydroxybenzo[b]furan

CAS: 40492-52-2

2,3-Dihydro-5-hydroxybenzo[b]furan

Formula: C₈H₈O₂

Purity: 97%

Color and Shape: powder

Molecular weight: 136.15g/mol

Ref: 54-OR42003

2,3-Dihydrobenzofuran-5-ol

CAS: 40492-52-2

Formula: C₈H₈O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 136.15

Ref: 10-F236890

2,3-Dihydro-5-hydroxybenzo[b]furan

CAS: 40492-52-2

2,3-Dihydro-5-hydroxybenzo[b]furan (2,3-DHBF) is a molecule that has been shown to have synergistic interaction with human polymorphonuclear leukocytes. This compound has also been found to inhibit the peroxidase-like activity and lipolytic enzymes of these cells. 2,3-DHBF may act as an antiinflammatory agent by inhibiting the production of inflammatory mediators. It also has antioxidant properties due to its ability to scavenge free radicals and protect against lipid peroxidation. The compound is soluble in organic solvents and can be synthesized from sulfonic acids and selenium compounds. 2,3-DHBF has also been found to have cytotoxic effects on heart tissue in rats.

Formula: C₈H₈O₂

Purity: Min. 95%

Molecular weight: 136.15 g/mol

Ref: 3D-QBA49252