CAS 405-03-8
:4-ethenyl-1,2-difluorobenzene
Description:
4-Ethenyl-1,2-difluorobenzene, also known by its CAS number 405-03-8, is an aromatic compound characterized by a benzene ring substituted with two fluorine atoms and a vinyl group (ethenyl) at the para position relative to each other. This compound typically exhibits a colorless to pale yellow liquid form and has a distinct aromatic odor. The presence of fluorine atoms enhances its chemical stability and influences its reactivity, making it useful in various applications, including as an intermediate in organic synthesis and in the production of fluorinated polymers. Its molecular structure contributes to its unique physical properties, such as a relatively low boiling point and moderate solubility in organic solvents. Additionally, 4-ethenyl-1,2-difluorobenzene may participate in electrophilic aromatic substitution reactions due to the electron-withdrawing nature of the fluorine substituents, which can affect the reactivity of the aromatic ring. Safety data should be consulted for handling, as fluorinated compounds can pose specific health and environmental risks.
Formula:C8H6F2
InChI:InChI=1/C8H6F2/c1-2-6-3-4-7(9)8(10)5-6/h2-5H,1H2
SMILES:C=Cc1ccc(c(c1)F)F
Synonyms:- 1,2-Difluoro-4-vinylbenzene
- Benzene, 4-Ethenyl-1,2-Difluoro-
- 3,4-Difluorostyrene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,4-Difluorostyrene
CAS:3,4-DifluorostyreneFormula:C8H6F2Purity:≥95%Color and Shape: clear. almost colourless liquidMolecular weight:140.13g/mol3,4-Difluorostyrene
CAS:Formula:C8H6F2Purity:98% (stabilized with TBC)Color and Shape:LiquidMolecular weight:140.1333,4-Difluorostyrene
CAS:3,4-Difluorostyrene is a synthetic compound that can be used to manufacture ticagrelor. It is an organic chemical with the chemical formula C8H6F2O2. 3,4-Difluorostyrene is an organic solvent and can be used as an antithrombotic agent. 3,4-Difluorostyrene has been shown to have optimum temperature of 40°C and is mainly used in preparative reactions.
Formula:C8H6F2Purity:Min. 95%Color and Shape:Colourless To Pale Yellow LiquidMolecular weight:140.13 g/mol



