CAS 405-06-1
:3-Fluoro-4-methylanisole
Description:
3-Fluoro-4-methylanisole, with the CAS number 405-06-1, is an organic compound that belongs to the class of anisoles, which are derivatives of methoxybenzene. This compound features a methoxy group (-OCH3) and a fluorine atom attached to the aromatic ring, specifically at the 3 and 4 positions, respectively. It is characterized by its molecular formula, which includes carbon, hydrogen, and fluorine atoms, contributing to its unique chemical properties. The presence of the fluorine atom can enhance the compound's reactivity and influence its physical properties, such as boiling and melting points. 3-Fluoro-4-methylanisole is typically a colorless to pale yellow liquid with a distinctive aromatic odor. It is used in various applications, including as an intermediate in organic synthesis and in the production of pharmaceuticals and agrochemicals. Additionally, its structural features may impart specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C8H9FO
InChI:InChI=1/C8H9FO/c1-6-3-4-7(10-2)5-8(6)9/h3-5H,1-2H3
SMILES:Cc1ccc(cc1F)OC
Synonyms:- 2-Fluoro-4-Methoxy-1-Methylbenzene
- 1-Fluoro-3-methoxy-6-methylbenzene，2-Fluoro-4-methoxytoluene
- 3-Fluoro-4-methylanisole 99%
- 3-Fluoro-4-methylanisole99%
- 3-FLUORO-4-METHYLANISOLE
- 2-Fluoro-4-methoxytoluene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Fluoro-4-methylanisole
CAS:<p>3-Fluoro-4-methylanisole</p>Purity:99%Color and Shape:LiquidMolecular weight:140.15g/mol3-Fluoro-4-methylanisole
CAS:<p>3-Fluoro-4-methylanisole is a nucleophilic, ring substituted electron acceptor that can be activated by electron donors. The nitro group and the electron donating substituents on the ring are important for this reactivity. 3-Fluoro-4-methylanisole can form substitution products with methyl or formyl groups in the presence of a strong base such as palladium, 3-fluoro-4-methylphenol, or nitro groups. This reactivity is regiospecific, meaning that the substitution will only occur at one of two possible sites on the ring. 3-Fluoro-4-methylanisole's chemical properties give it both activating and deactivating properties in organic reactions.</p>Formula:C8H9FOPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:140.15 g/mol
