CAS 405-67-4
:N-ethyl-4-fluoroaniline
Description:
N-ethyl-4-fluoroaniline is an organic compound characterized by its aromatic amine structure, featuring a fluorine atom and an ethyl group attached to a benzene ring. The presence of the fluorine atom at the para position relative to the amino group significantly influences its chemical properties, including its reactivity and solubility. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its moderate toxicity and should be handled with care, as it can cause skin and eye irritation. N-ethyl-4-fluoroaniline is primarily used in the synthesis of dyes, pharmaceuticals, and agrochemicals, owing to its ability to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. Additionally, its unique electronic properties make it a valuable intermediate in organic synthesis. Proper safety measures should be observed when working with this compound, including the use of personal protective equipment and adequate ventilation.
Formula:C8H10FN
InChI:InChI=1/C8H10FN/c1-2-10-8-5-3-7(9)4-6-8/h3-6,10H,2H2,1H3
SMILES:CCNc1ccc(cc1)F
Synonyms:- benzenamine, N-ethyl-4-fluoro-
- N-ethyl-N-(4-fluorophenyl)amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N-ETHYL-N-(4-FLUOROPHENYL)AMINE
CAS:Formula:C8H10FNPurity:98%Color and Shape:LiquidMolecular weight:139.1701N-ethyl-4-fluoroaniline
CAS:N-ethyl-4-fluoroanilineFormula:C8H10FNPurity:≥95%Color and Shape: clear liquidMolecular weight:139.17g/molN-Ethyl-4-fluoroaniline
CAS:N-Ethyl-4-fluoroaniline is a chemical compound that has been shown to have antitubercular activity. The minimal inhibitory concentration of this drug was determined using a broth microdilution technique. N-Ethyl-4-fluoroaniline was found to be active against extensively drug resistant TB (XDRTB) strains, including H37Rv, the most common strain of Mycobacterium tuberculosis. This compound binds to the amines on the cell membrane and cleaves bonds on the surface of the bacterium, preventing its growth. This drug also has anti-inflammatory properties and can be used to treat other bacterial infections.Formula:C8H10FNPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:139.17 g/mol



