CAS 40503-90-0: 4-(4-methylphenyl)cyclohexanone
Description:4-(4-Methylphenyl)cyclohexanone, also known by its CAS number 40503-90-0, is an organic compound characterized by a cyclohexanone structure substituted with a para-methylphenyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It has a distinct aromatic odor due to the presence of the phenyl group. The molecular structure features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. This compound is often used as an intermediate in the production of various pharmaceuticals, agrochemicals, and other organic compounds. Its solubility is generally higher in organic solvents than in water, reflecting its hydrophobic nature. Additionally, 4-(4-methylphenyl)cyclohexanone may exhibit moderate to low toxicity, necessitating appropriate safety measures during handling and use. As with many organic compounds, it is important to consider its stability, reactivity, and potential environmental impact when utilized in industrial or laboratory settings.
Formula:C13H16O
InChI:InChI=1S/C13H16O/c1-10-2-4-11(5-3-10)12-6-8-13(14)9-7-12/h2-5,12H,6-9H2,1H3
InChI key:InChIKey=XDHMORMQXOUOHT-UHFFFAOYSA-N
SMILES:O=C1CCC(C2=CC=C(C=C2)C)CC1
- Synonyms:
- 4-(p-Tolyl)cyclohexanone
- Cyclohexanone, 4-(4-Methylphenyl)-
- 4-(4-Methylphenyl)cyclohexanone
4-(p-Tolyl)cyclohexanone
Ref: 3B-T3418
| 1g | 87.00 € |
4-(4-Methylphenyl)cyclohexanone
Ref: IN-DA0076YV
| 100mg | 69.00 € | ||
| 250mg | 127.00 € |
Ref: 54-OR1023830
| 100mg | 38.00 € | ||
| 250mg | 59.00 € |
4-(4-Methylphenyl)cyclohexanone
Ref: 10-F230808
| 5g | To inquire |
4-(4-Methylphenyl)cyclohexanone
Ref: 3D-FM152353
| 25mg | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
