CymitQuimica logo

CAS 405057-75-2

:

1-Piperidinecarboxylicacid, 4-(methylamino)-, phenylmethylester

Description:
1-Piperidinecarboxylic acid, 4-(methylamino)-, phenylmethyl ester, identified by CAS number 405057-75-2, is a chemical compound that features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. This compound is characterized by the presence of a carboxylic acid functional group and an ester linkage, specifically a phenylmethyl ester. The methylamino group at the 4-position of the piperidine ring contributes to its basicity and potential reactivity. The structure suggests that it may exhibit both polar and nonpolar characteristics, making it soluble in various organic solvents. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. Its properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. As with many organic compounds, safety data and handling precautions should be considered when working with this substance.
Formula:C14H20N2O2
InChI:InChI=1S/C14H20N2O2/c1-15-13-7-9-16(10-8-13)14(17)18-11-12-5-3-2-4-6-12/h2-6,13,15H,7-11H2,1H3
InChI key:UKMMXAXGJCWGTF-UHFFFAOYSA-N
SMILES:CNC1CCN(CC1)C(=O)OCC2=CC=CC=C2
Synonyms:
  • 1-(Benzyloxycarbonyl)-4-methylaminopiperidine
Found 4 products.