CAS 405057-76-3

Phenylmethyl 4-[[(1,1-dimethylethoxy)carbonyl]methylamino]-1-piperidinecarboxylate

Description:

Phenylmethyl 4-[[(1,1-dimethylethoxy)carbonyl]methylamino]-1-piperidinecarboxylate, identified by its CAS number 405057-76-3, is a synthetic organic compound characterized by its complex structure, which includes a piperidine ring, a phenylmethyl group, and a dimethylethoxycarbonyl moiety. This compound typically exhibits properties associated with piperidine derivatives, such as potential biological activity, including analgesic or anti-inflammatory effects, depending on its specific interactions with biological targets. It is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its hydrophobic phenyl and piperidine components. The presence of the dimethylethoxycarbonyl group suggests that it may participate in various chemical reactions, including hydrolysis or nucleophilic substitution. As with many synthetic compounds, its stability, reactivity, and potential applications in medicinal chemistry or drug development would be of interest, warranting further investigation into its pharmacological properties and safety profile.

Formula: C₁₉H₂₈N₂O₄

InChI: InChI=1S/C19H28N2O4/c1-19(2,3)25-17(22)20(4)16-10-12-21(13-11-16)18(23)24-14-15-8-6-5-7-9-15/h5-9,16H,10-14H2,1-4H3

InChI key: InChIKey=IGHROSQZBYLAIY-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)(C)C1CCN(C(OCC2=CC=CC=C2)=O)CC1

Synonyms:

• 1-Piperidinecarboxylic acid, 4-[[(1,1-dimethylethoxy)carbonyl]methylamino]-, phenylmethyl ester
• 4-[(tert-Butoxycarbonyl)(methyl)amino]piperidine-1-carboxylic acid benzyl ester
• Phenylmethyl 4-[[(1,1-dimethylethoxy)carbonyl]methylamino]-1-piperidinecarboxylate

Benzyl 4-((tert-butoxycarbonyl)(methyl)amino)piperidine-1-carboxylate

CAS: 405057-76-3

Formula: C₁₉H₂₈N₂O₄

Purity: 95.0%

Molecular weight: 348.443

Ref: 10-F241650