
CAS 40509-16-8
:3,3′-Iminobis[1,2-propanediol]
Description:
3,3′-Iminobis[1,2-propanediol], also known as bis(2-hydroxypropyl)amine, is an organic compound characterized by its amine functional group and two hydroxyl groups. This substance is a colorless to pale yellow liquid at room temperature and is soluble in water due to its polar hydroxyl groups. It has a relatively low molecular weight and exhibits properties typical of both amines and alcohols, making it a versatile compound in various applications. The presence of the imino group contributes to its ability to form hydrogen bonds, enhancing its reactivity and solubility in polar solvents. 3,3′-Iminobis[1,2-propanediol] is often utilized in the synthesis of surfactants, pharmaceuticals, and as a chelating agent in various chemical processes. Its safety profile indicates that it should be handled with care, as it may cause irritation upon contact with skin or eyes. Overall, this compound plays a significant role in industrial and laboratory settings due to its functional versatility.
Formula:C6H15NO4
InChI:InChI=1S/C6H15NO4/c8-3-5(10)1-7-2-6(11)4-9/h5-11H,1-4H2
InChI key:InChIKey=SAMGBMSEBPZABZ-UHFFFAOYSA-N
SMILES:C(NCC(CO)O)C(CO)O
Synonyms:- 1,2-Propanediol, 3,3′-iminodi-
- 2,2′-Dihydroxydipropanolamine
- 1,2-Propanediol, 3,3′-iminobis-
- 3,3′-Iminobis[1,2-propanediol]
- Bis(2,3-dihydroxypropyl)amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
N,N-Bis(2,3-dihydroxypropyl)amine
CAS:Controlled ProductFormula:C6H15NO4Color and Shape:NeatMolecular weight:165.188

