CymitQuimica logo

CAS 405090-68-8

:

3-[(3-fluorophenoxy)methyl]piperidine

Description:
3-[(3-Fluorophenoxy)methyl]piperidine is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a fluorophenoxy group at the 3-position of the piperidine ring contributes to its unique properties, including potential lipophilicity and biological activity. The fluorine atom in the phenoxy group can enhance the compound's metabolic stability and influence its interaction with biological targets. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry and drug development. Its structure suggests potential applications in areas such as neuropharmacology or as a building block for synthesizing more complex molecules. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, and its behavior in biological systems would depend on factors such as its ability to cross biological membranes and bind to specific receptors or enzymes. As with many compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C12H16FNO
InChI:InChI=1/C12H16FNO/c13-11-4-1-5-12(7-11)15-9-10-3-2-6-14-8-10/h1,4-5,7,10,14H,2-3,6,8-9H2
SMILES:c1cc(cc(c1)OCC1CCCNC1)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.