CAS 40513-34-6
:3-Amino-5-methyl-2-hexanone
Description:
3-Amino-5-methyl-2-hexanone, with the CAS number 40513-34-6, is an organic compound characterized by the presence of an amino group and a ketone functional group within its structure. This compound features a six-carbon chain, with a methyl group and an amino group positioned at specific locations on the chain, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the amino group makes it a potential candidate for various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, the ketone functionality can participate in reactions such as oxidation and reduction. 3-Amino-5-methyl-2-hexanone may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. However, its handling requires caution due to potential toxicity and the need for proper safety measures in laboratory settings. As with many organic compounds, its reactivity and stability can be influenced by environmental conditions such as temperature and pH.
Formula:C7H15NO
InChI:InChI=1S/C7H15NO/c1-5(2)4-7(8)6(3)9/h5,7H,4,8H2,1-3H3
InChI key:InChIKey=RVCJZAGFTBLSSU-UHFFFAOYSA-N
SMILES:C(CC(C)C)(C(C)=O)N
Synonyms:- 3-Amino-5-methylhexan-2-one
- 2-Hexanone, 3-amino-5-methyl-
- 2-hexanone, 3-amino-5-methyl-
- NSC 242674
- 3-Amino-5-methyl-2-hexanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
