CAS 405150-20-1

S-1,3-thiazol-2-yl-L-cysteine

Description:

S-1,3-thiazol-2-yl-L-cysteine is a chemical compound characterized by its unique structure, which includes a thiazole ring and an amino acid backbone. The thiazole moiety contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and bioactive compounds. This compound features a cysteine residue, which is notable for containing a thiol (-SH) group, making it reactive and capable of forming disulfide bonds. The presence of the sulfur atom in both the thiazole and cysteine enhances its reactivity and potential interactions with other biomolecules. S-1,3-thiazol-2-yl-L-cysteine may exhibit antioxidant properties due to the thiol group, and it could play a role in cellular signaling or as a precursor in the synthesis of other biologically relevant molecules. Its specific applications and effects would depend on further research, particularly in the fields of medicinal chemistry and biochemistry, where such compounds are often explored for therapeutic potential.

Formula: C₆H₈N₂O₂S₂

InChI: InChI=1/C6H8N2O2S2/c7-4(5(9)10)3-12-6-8-1-2-11-6/h1-2,4H,3,7H2,(H,9,10)/t4-/m0/s1

SMILES: c1csc(n1)SC[C@@H](C(=O)O)N

S-(2-Thiazolyl)-L-cysteine

CAS: 405150-20-1

Formula: C₆H₈N₂O₂S₂

Molecular weight: 204.2699

Ref: IN-DA003U62

S-(2-Thiazolyl)-L-Cysteine

CAS: 405150-20-1

Formula: C₆H₈N₂O₂S₂

Color and Shape: White To Off-White Solid

Molecular weight: 204.26

Ref: 4Z-C-7766

S-(2-Thiazolyl)-L-cysteine

CAS: 405150-20-1

Molecular weight: 204.27

Ref: 7W-GM5667

S-2-Thiazolyl-L-cysteine

Controlled Product

CAS: 405150-20-1

Applications S-2-Thiazolyl-L-cysteine is used in the semisynthetic production of unnatural L-α-amino acids by metabolic engineering of the cysteine-biosynthetic pathway.
References Maier, T. H. P., et al.: Nat. Biotechnol., 21, 422 (2003);

Formula: C₆H₈N₂O₂S₂

Color and Shape: Neat

Molecular weight: 204.27

Ref: TR-T344740