CAS 405230-82-2

2,5-Dichloro-4-aminopyridine

Description:

2,5-Dichloro-4-aminopyridine is an organic compound characterized by its pyridine ring, which is substituted at the 2 and 5 positions with chlorine atoms and at the 4 position with an amino group. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry and as a building block in organic synthesis. It exhibits properties such as moderate solubility in polar solvents, which can facilitate its use in various chemical reactions. The presence of both chlorine and amino functional groups contributes to its reactivity, allowing for further derivatization. Additionally, 2,5-Dichloro-4-aminopyridine may exhibit biological activity, making it of interest in pharmacological research. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks. Overall, this compound serves as a valuable intermediate in the synthesis of more complex molecules in the field of organic chemistry.

Formula: C₅H₄Cl₂N₂

InChI: InChI=1/C5H4Cl2N2/c6-3-2-9-5(7)1-4(3)8/h1-2H,(H2,8,9)

SMILES: c1c(c(cnc1Cl)Cl)N

Synonyms:

• 2,5-Dichloropyridin-4-Amine
• 4-Pyridinamine, 2,5-dichloro-

4-Pyridinamine,2,5-dichloro-(9CI)

CAS: 405230-82-2

Formula: C₅H₄Cl₂N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 163.0047

Ref: IN-DA00C6YM

4-Amino-2,5-dichloropyridine

CAS: 405230-82-2

4-Amino-2,5-dichloropyridine

Purity: 98%

Color and Shape: Colourless Liquid

Molecular weight: 163.00466g/mol

Ref: 54-OR302617

2,5-Dichloropyridin-4-amine

CAS: 405230-82-2

Formula: C₅H₄Cl₂N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 163

Ref: 10-F215756