CAS 405230-95-7
:3H-Imidazo[4,5-c]pyridine,4,6,7-trifluoro-
Description:
3H-Imidazo[4,5-c]pyridine, 4,6,7-trifluoro- is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. The presence of trifluoromethyl groups at the 4, 6, and 7 positions significantly influences its reactivity and polarity, making it a valuable compound in medicinal chemistry and material science. This compound is typically a solid at room temperature and exhibits moderate solubility in polar organic solvents. Its trifluoromethyl substituents enhance lipophilicity and can improve biological activity, making it a candidate for various pharmaceutical applications. The compound's structure allows for potential interactions with biological targets, which is of interest in drug design. Additionally, its stability under various conditions makes it suitable for synthetic applications. Overall, 3H-Imidazo[4,5-c]pyridine, 4,6,7-trifluoro- is notable for its unique structural features and potential utility in various chemical and biological contexts.
Formula:C6H2F3N3
InChI:InChI=1S/C6H2F3N3/c7-2-3-4(11-1-10-3)6(9)12-5(2)8/h1H,(H,10,11)
InChI key:YKMPKBMAZVYSDI-UHFFFAOYSA-N
SMILES:C1=NC2=C(N1)C(=NC(=C2F)F)F
Synonyms:- 1H-Imidazo[4,5-c]pyridine,4,6,7-trifluoro- (9CI)
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery