CAS 405278-58-2

4-amino-N-(2-methylpropyl)-1,2,5-oxadiazole-3-carboxamide

Description:

4-amino-N-(2-methylpropyl)-1,2,5-oxadiazole-3-carboxamide, with the CAS number 405278-58-2, is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features an amino group and a carboxamide functional group, contributing to its potential as a bioactive molecule. The presence of the 2-methylpropyl substituent enhances its lipophilicity, which may influence its solubility and permeability in biological systems. The oxadiazole moiety is often associated with various pharmacological activities, making this compound of interest in medicinal chemistry. Its structural characteristics suggest potential applications in drug development, particularly in areas requiring compounds with specific biological activities. Additionally, the stability and reactivity of the functional groups present in this molecule can be explored for various synthetic applications. Overall, 4-amino-N-(2-methylpropyl)-1,2,5-oxadiazole-3-carboxamide represents a unique structure that may offer diverse chemical and biological properties.

Formula: C₇H₁₂N₄O₂

InChI: InChI=1/C7H12N4O2/c1-4(2)3-9-7(12)5-6(8)11-13-10-5/h4H,3H2,1-2H3,(H2,8,11)(H,9,12)

SMILES: CC(C)CN=C(c1c(N)non1)O

4-Amino-N-isobutyl-1,2,5-oxadiazole-3-carboxamide

CAS: 405278-58-2

Formula: C₇H₁₂N₄O₂

Purity: 95.0%

Molecular weight: 184.199

Ref: 10-F061523