CymitQuimica logo

CAS 4053-45-6

:

5-(Chloromethyl)-8-hydroxyquinoline hydrochloride

Description:
5-(Chloromethyl)-8-hydroxyquinoline hydrochloride is a chemical compound characterized by its quinoline structure, which features a hydroxyl group and a chloromethyl substituent. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it useful in different chemical applications. The presence of the hydroxyl group contributes to its potential as a chelating agent, allowing it to form complexes with metal ions, which can be advantageous in various fields, including biochemistry and materials science. The chloromethyl group can also serve as a reactive site for further chemical modifications, enhancing its utility in synthetic chemistry. Additionally, this compound may exhibit biological activity, including antimicrobial properties, which has led to its investigation in pharmaceutical research. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity and reactivity.
Formula:C10H8ClNO·ClH
InChI:InChI=1S/C10H8ClNO.ClH/c11-6-7-3-4-9(13)10-8(7)2-1-5-12-10;/h1-5,13H,6H2;1H
InChI key:InChIKey=BDQGTRWOFVSOQX-UHFFFAOYSA-N
SMILES:C(Cl)C=1C2=C(C(O)=CC1)N=CC=C2.Cl
Synonyms:
  • 5-(Chloromethyl)-8-hydroxyquinoline hydrochloride
  • 5-(Chloromethyl)-8-quinolinol hydrochloride
  • 5-(Chloromethyl)Quinolin-8-Ol Hydrochloride
  • 8-Quinolinol, 5-(chloromethyl)-, hydrochloride
  • 8-Quinolinol, 5-(chloromethyl)-, hydrochloride (1:1)
Found 4 products.