CAS 40530-18-5
:5-Bromo-2-hydroxybenzonitrile
Description:
5-Bromo-2-hydroxybenzonitrile, with the CAS number 40530-18-5, is an organic compound that features a bromine atom, a hydroxyl group, and a nitrile functional group attached to a benzene ring. This compound is characterized by its aromatic structure, which contributes to its stability and reactivity. The presence of the bromine atom enhances its electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions. The hydroxyl group provides hydrogen bonding capabilities, which can influence its solubility in polar solvents. Additionally, the nitrile group contributes to the compound's polarity and can participate in further chemical transformations. 5-Bromo-2-hydroxybenzonitrile is typically used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its unique combination of functional groups allows for diverse applications in chemical research and industrial processes. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C7H4BrNO
InChI:InChI=1S/C7H4BrNO/c8-6-1-2-7(10)5(3-6)4-9/h1-3,10H
InChI key:InChIKey=PVCONXMDUZOPJH-UHFFFAOYSA-N
SMILES:C(#N)C1=C(O)C=CC(Br)=C1
Synonyms:- 2-Hydroxy-5-bromobenzonitrile
- 4-Bromo-2-cyanophenol
- 5-Bromo-2-Hydroxybenzenecarbonitrile
- 5-Bromosalicylonitrile
- Benzonitrile, 5-bromo-2-hydroxy-
- 5-Bromo-2-hydroxybenzonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Bromo-2-hydroxybenzonitrile
CAS:Formula:C7H4BrNOPurity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:198.02Benzonitrile, 5-bromo-2-hydroxy-
CAS:Formula:C7H4BrNOPurity:98%Color and Shape:SolidMolecular weight:198.01685-Bromo-2-hydroxybenzonitrile
CAS:Formula:C7H4BrNOPurity:98%Color and Shape:SolidMolecular weight:198.0195-Bromo-2-hydroxybenzonitrile
CAS:5-Bromo-2-hydroxybenzonitrileFormula:C7H4BrNOPurity:98%Color and Shape: beige solidMolecular weight:198.02g/mol4-Bromo-2-cyanophenol
CAS:4-Bromo-2-cyanophenol is a metabotropic glutamate receptor ligand that has been shown to be an agonist of the group II metabotropic glutamate receptors. It binds to this type of glutamate receptor and stimulates the release of the neurotransmitter, glutamate. 4-Bromo-2-cyanophenol is used as a reagent in microscopy experiments to analyze lamellar structures. It has also been used in the synthesis of benzofuran derivatives and formamide. 4-Bromo-2-cyanophenol can be prepared by reacting hydrochloric acid with mesomorphic formamide, followed by desorption with monomers such as hexamethylene diamine or ethylene glycol.
Formula:C7H4BrNOPurity:Min. 95%Color and Shape:PowderMolecular weight:198.02 g/mol




