CAS 40545-33-3
:2-Amino-5-methylbenzamide
Description:
2-Amino-5-methylbenzamide, with the CAS number 40545-33-3, is an organic compound characterized by the presence of an amino group (-NH2) and a methyl group (-CH3) attached to a benzene ring that also contains a carbonyl group (amide). This compound is a derivative of aniline and is classified as an aromatic amide. It typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of the amine functional group, which can engage in hydrogen bonding. The compound is of interest in various fields, including pharmaceuticals and organic synthesis, due to its potential biological activity and utility as an intermediate in the synthesis of more complex molecules. Its chemical properties, such as melting point, boiling point, and reactivity, can vary based on the specific conditions and the presence of other functional groups in a reaction. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H10N2O
InChI:InChI=1/C8H10N2O/c1-5-2-3-7(9)6(4-5)8(10)11/h2-4H,9H2,1H3,(H2,10,11)
SMILES:Cc1ccc(c(c1)C(=N)O)N
Synonyms:- Benzamide, 2-Amino-5-Methyl-
- 2-AMINO-5-METHYLBENZAMIDE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Amino-5-methylbenzamide
CAS:Formula:C8H10N2OPurity:97%Color and Shape:SolidMolecular weight:150.17782-Amino-5-methylbenzamide
CAS:2-Amino-5-methylbenzamide (2AMB) is a potent inhibitor of the enzyme dihydropyrimidine dehydrogenase and is used in cancer research for its ability to inhibit tumor cell line growth. 2AMB has been shown to inhibit the synthesis of DNA, RNA, and protein in various human cell lines. The mechanism of this inhibition is not well understood, but it may be due to its ability to inhibit the activity of synthetases involved in nucleotide biosynthesis or by inhibiting the reaction system that converts hydration into ATP.Formula:C8H10N2OPurity:Min. 95%Color and Shape:PowderMolecular weight:150.18 g/mol2-Amino-5-methylbenzamide
CAS:Formula:C8H10N2OPurity:95%Color and Shape:SolidMolecular weight:150.181



