CAS 405513-13-5

Methyl (3S,5S)-5-methyl-3-piperidinecarboxylate

Description:

Methyl (3S,5S)-5-methyl-3-piperidinecarboxylate is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. The compound features a carboxylate functional group, indicating it is an ester, specifically a methyl ester, due to the presence of a methyl group attached to the carboxylate. The stereochemistry of the molecule is defined by the (3S,5S) configuration, which indicates the specific spatial arrangement of the substituents around the chiral centers at the 3rd and 5th positions of the piperidine ring. This stereochemistry can significantly influence the compound's biological activity and interactions. Methyl (3S,5S)-5-methyl-3-piperidinecarboxylate is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its properties, such as solubility, boiling point, and reactivity, are influenced by the presence of the piperidine ring and the ester functional group, making it a compound of interest in various chemical applications.

Formula: C₈H₁₅NO₂

InChI: InChI=1S/C8H15NO2/c1-6-3-7(5-9-4-6)8(10)11-2/h6-7,9H,3-5H2,1-2H3/t6-,7-/m0/s1

InChI key: InChIKey=HJPYJRXRHXOATI-BQBZGAKWSA-N

SMILES: C(OC)(=O)[C@H]1C[C@H](C)CNC1

Synonyms:

• 3-Piperidinecarboxylic acid, 5-methyl-, methyl ester, (3S,5S)-
• Methyl (3S,5S)-5-methyl-3-piperidinecarboxylate
• 3-Piperidinecarboxylicacid,5-methyl-,methylester,(3S,5S)-(9CI)